C31H32N2O — CID 150680372
2,4-bis(2,6-dimethyl-4-pyridinyl)-1,5-diphenylpentan-3-one (PubChem CID 150680372) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is 2,4-bis(2,6-dimethyl-4-pyridinyl)-1,5-diphenylpentan-3-one.
| Compound Name | 2,4-bis(2,6-dimethyl-4-pyridinyl)-1,5-diphenylpentan-3-one |
|---|---|
| PubChem CID | 150680372 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2,4-bis(2,6-dimethyl-4-pyridinyl)-1,5-diphenylpentan-3-one |
| SMILES | Cc1cc(C(Cc2ccccc2)C(=O)C(Cc2ccccc2)c2cc(C)nc(C)c2)cc(C)n1 |
| InChI | InChI=1S/C31H32N2O/c1-21-15-27(16-22(2)32-21)29(19-25-11-7-5-8-12-25)31(34)30(20-26-13-9-6-10-14-26)28-17-23(3)33-24(4)18-28/h5-18,29-30H,19-20H2,1-4H3 |
| InChIKey | JHSWZVCGYBCMRN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |