C15H16N2O3 — CID 104572433
3-(3-methoxyphenyl)-2-(6-methylpyrimidin-4-yl)propanoic acid (PubChem CID 104572433) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-(6-methylpyrimidin-4-yl)propanoic acid.
| Compound Name | 3-(3-methoxyphenyl)-2-(6-methylpyrimidin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 104572433 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-(6-methylpyrimidin-4-yl)propanoic acid |
| SMILES | COc1cccc(CC(C(=O)O)c2cc(C)ncn2)c1 |
| InChI | InChI=1S/C15H16N2O3/c1-10-6-14(17-9-16-10)13(15(18)19)8-11-4-3-5-12(7-11)20-2/h3-7,9,13H,8H2,1-2H3,(H,18,19) |
| InChIKey | IXEYENKTGLYDDT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |