C13H10FN5O2 — CID 104572997
3-(4-fluorophenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid (PubChem CID 104572997) has the molecular formula C13H10FN5O2 and a molecular weight of 287.25 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 104572997 |
| Molecular Formula | C13H10FN5O2 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(F)cc1)c1cncc2nnnn12 |
| InChI | InChI=1S/C13H10FN5O2/c14-9-3-1-8(2-4-9)5-10(13(20)21)11-6-15-7-12-16-17-18-19(11)12/h1-4,6-7,10H,5H2,(H,20,21) |
| InChIKey | MKSXGJRIJVQJNO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |