C14H13N5O2 — CID 104573126
3-(4-methylphenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid (PubChem CID 104573126) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid.
| Compound Name | 3-(4-methylphenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 104573126 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-(4-methylphenyl)-2-(tetrazolo[1,5-a]pyrazin-5-yl)propanoic acid |
| SMILES | Cc1ccc(CC(C(=O)O)c2cncc3nnnn23)cc1 |
| InChI | InChI=1S/C14H13N5O2/c1-9-2-4-10(5-3-9)6-11(14(20)21)12-7-15-8-13-16-17-18-19(12)13/h2-5,7-8,11H,6H2,1H3,(H,20,21) |
| InChIKey | VKGZWSXGZMBPIO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |