C12H9N5O2S — CID 64927980
2-[4-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)phenyl]acetic acid (PubChem CID 64927980) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[4-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)phenyl]acetic acid.
| Compound Name | 2-[4-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 64927980 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[4-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Sc2cncc3nnnn23)cc1 |
| InChI | InChI=1S/C12H9N5O2S/c18-12(19)5-8-1-3-9(4-2-8)20-11-7-13-6-10-14-15-16-17(10)11/h1-4,6-7H,5H2,(H,18,19) |
| InChIKey | CIQVJINFADTNKM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |