C14H11N3O2S — CID 115372236
2-(4-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylphenyl)acetic acid (PubChem CID 115372236) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-(4-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylphenyl)acetic acid.
| Compound Name | 2-(4-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 115372236 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(4-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylphenyl)acetic acid |
| SMILES | O=C(O)Cc1ccc(Sc2ccn3nccc3n2)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c18-14(19)9-10-1-3-11(4-2-10)20-13-6-8-17-12(16-13)5-7-15-17/h1-8H,9H2,(H,18,19) |
| InChIKey | UQGFWABDGRZIDW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |