C10H13N3OS — CID 115372691
3-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylbutan-1-ol (PubChem CID 115372691) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylbutan-1-ol.
| Compound Name | 3-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 115372691 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-pyrazolo[1,5-a]pyrimidin-5-ylsulfanylbutan-1-ol |
| SMILES | CC(CCO)Sc1ccn2nccc2n1 |
| InChI | InChI=1S/C10H13N3OS/c1-8(4-7-14)15-10-3-6-13-9(12-10)2-5-11-13/h2-3,5-6,8,14H,4,7H2,1H3 |
| InChIKey | MUPCNPHMAMPUOC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |