C11H16N4O2 — CID 114243521
2-[2-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]ethoxy]ethanol (PubChem CID 114243521) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-[2-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114243521 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[2-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]ethoxy]ethanol |
| SMILES | CN(CCOCCO)c1ccn2nccc2n1 |
| InChI | InChI=1S/C11H16N4O2/c1-14(6-8-17-9-7-16)10-3-5-15-11(13-10)2-4-12-15/h2-5,16H,6-9H2,1H3 |
| InChIKey | CMUAGAYWIKHDNC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|