C11H15N5S — CID 113296606
2-methyl-3-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide (PubChem CID 113296606) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-methyl-3-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide.
| Compound Name | 2-methyl-3-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 113296606 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-methyl-3-[methyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide |
| SMILES | CC(CN(C)c1ccn2nccc2n1)C(N)=S |
| InChI | InChI=1S/C11H15N5S/c1-8(11(12)17)7-15(2)9-4-6-16-10(14-9)3-5-13-16/h3-6,8H,7H2,1-2H3,(H2,12,17) |
| InChIKey | VCDRWRIIMVRLRG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|