C12H15N5S — CID 115372209
3-[cyclopropyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide (PubChem CID 115372209) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[cyclopropyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide.
| Compound Name | 3-[cyclopropyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 115372209 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[cyclopropyl(pyrazolo[1,5-a]pyrimidin-5-yl)amino]propanethioamide |
| SMILES | NC(=S)CCN(c1ccn2nccc2n1)C1CC1 |
| InChI | InChI=1S/C12H15N5S/c13-10(18)4-7-16(9-1-2-9)11-5-8-17-12(15-11)3-6-14-17/h3,5-6,8-9H,1-2,4,7H2,(H2,13,18) |
| InChIKey | JMGYPQIFPPIDGX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|