C8H10ClN5 — CID 63202766
5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine (PubChem CID 63202766) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine.
| Compound Name | 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 63202766 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine |
| SMILES | CC(Cl)C(C)c1cncc2nnnn12 |
| InChI | InChI=1S/C8H10ClN5/c1-5(6(2)9)7-3-10-4-8-11-12-13-14(7)8/h3-6H,1-2H3 |
| InChIKey | NOKWUYJHXIAQIT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|