About 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine
5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine (PubChem CID 63202766) has the molecular formula C8H10ClN5
and a molecular weight of 211.66 g/mol. Its IUPAC name is 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine |
| PubChem CID | 63202766 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine |
| SMILES | CC(Cl)C(C)c1cncc2nnnn12 |
| InChI | InChI=1S/C8H10ClN5/c1-5(6(2)9)7-3-10-4-8-11-12-13-14(7)8/h3-6H,1-2H3 |
| InChIKey | NOKWUYJHXIAQIT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine?
The IUPAC name of 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine (CID 63202766) is 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine is CC(Cl)C(C)c1cncc2nnnn12.
What is the InChIKey of 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine?
The InChIKey is NOKWUYJHXIAQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN5/c1-5(6(2)9)7-3-10-4-8-11-12-13-14(7)8/h3-6H,1-2H3.
What are the key properties of 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine?
5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine has a molecular weight of 211.66 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorobutan-2-yl)tetrazolo[1,5-a]pyrazine is sourced from PubChem (CID 63202766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).