C7H10N6 — CID 63196883
1-(tetrazolo[1,5-a]pyrazin-5-yl)propan-2-amine (PubChem CID 63196883) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is 1-(tetrazolo[1,5-a]pyrazin-5-yl)propan-2-amine.
| Compound Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 63196883 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)propan-2-amine |
| SMILES | CC(N)Cc1cncc2nnnn12 |
| InChI | InChI=1S/C7H10N6/c1-5(8)2-6-3-9-4-7-10-11-12-13(6)7/h3-5H,2,8H2,1H3 |
| InChIKey | UFWGGZNMRAGETD-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |