C10H14N6O2 — CID 104683126
2-methyl-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)pentanoic acid (PubChem CID 104683126) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-methyl-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)pentanoic acid.
| Compound Name | 2-methyl-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 104683126 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-methyl-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)pentanoic acid |
| SMILES | CC(CCCNc1cncc2nnnn12)C(=O)O |
| InChI | InChI=1S/C10H14N6O2/c1-7(10(17)18)3-2-4-12-8-5-11-6-9-13-14-15-16(8)9/h5-7,12H,2-4H2,1H3,(H,17,18) |
| InChIKey | BAWKAMFRJUEWRY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|