C9H13N7O — CID 114143012
3-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)butanamide (PubChem CID 114143012) has the molecular formula C9H13N7O and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)butanamide.
| Compound Name | 3-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)butanamide |
|---|---|
| PubChem CID | 114143012 |
| Molecular Formula | C9H13N7O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-methyl-3-(tetrazolo[1,5-a]pyrazin-5-ylamino)butanamide |
| SMILES | CC(C)(CC(N)=O)Nc1cncc2nnnn12 |
| InChI | InChI=1S/C9H13N7O/c1-9(2,3-6(10)17)12-7-4-11-5-8-13-14-15-16(7)8/h4-5,12H,3H2,1-2H3,(H2,10,17) |
| InChIKey | VEWIHYVLBXSADN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |