C9H13BrN6O — CID 80674800
N-(2-bromo-3-methoxypropyl)-N-methyltetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 80674800) has the molecular formula C9H13BrN6O and a molecular weight of 301.15 g/mol. Its IUPAC name is N-(2-bromo-3-methoxypropyl)-N-methyltetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-(2-bromo-3-methoxypropyl)-N-methyltetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 80674800 |
| Molecular Formula | C9H13BrN6O |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(2-bromo-3-methoxypropyl)-N-methyltetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | COCC(Br)CN(C)c1cncc2nnnn12 |
| InChI | InChI=1S/C9H13BrN6O/c1-15(5-7(10)6-17-2)9-4-11-3-8-12-13-14-16(8)9/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JBDGZYPOOTVHSZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|