C10H17N7 — CID 62586413
N,N'-diethyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine (PubChem CID 62586413) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is N,N'-diethyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62586413 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N,N'-diethyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1cncc2nnnn12 |
| InChI | InChI=1S/C10H17N7/c1-3-11-5-6-16(4-2)10-8-12-7-9-13-14-15-17(9)10/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | MDXJDGZEASSSFN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|