methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate

C8H10N6O2 — CID 62004531

IUPACmethyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate
SMILESCOC(=O)CN(C)c1cncc2nnnn12
InChIInChI=1S/C8H10N6O2/c1-13(5-8(15)16-2)7-4-9-3-6-10-11-12-14(6)7/h3-4H,5H2,1-2H3
InChIKeyBFLFFYWXHFZKAQ-UHFFFAOYSA-N
MW222.21 g/mol
LogP-0.87
Rot. Bonds3

About methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate

methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate (PubChem CID 62004531) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate
PubChem CID62004531
Molecular FormulaC8H10N6O2
Molecular Weight222.21 g/mol
Exact Mass222.09
IUPAC Namemethyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate
SMILESCOC(=O)CN(C)c1cncc2nnnn12
InChIInChI=1S/C8H10N6O2/c1-13(5-8(15)16-2)7-4-9-3-6-10-11-12-14(6)7/h3-4H,5H2,1-2H3
InChIKeyBFLFFYWXHFZKAQ-UHFFFAOYSA-N
XLogP-0.87
TPSA85.51 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.21
LogP ≤ 5-0.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate?
The IUPAC name of methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate (CID 62004531) is methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate.
What is the SMILES notation for methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate?
The canonical SMILES for methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate is COC(=O)CN(C)c1cncc2nnnn12.
What is the InChIKey of methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate?
The InChIKey is BFLFFYWXHFZKAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6O2/c1-13(5-8(15)16-2)7-4-9-3-6-10-11-12-14(6)7/h3-4H,5H2,1-2H3.
What are the key properties of methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate?
methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate has a molecular weight of 222.21 g/mol, XLogP of -0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(tetrazolo[1,5-a]pyrazin-5-yl)amino]acetate is sourced from PubChem (CID 62004531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).