C9H11N5O2S — CID 66113967
methyl 3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)butanoate (PubChem CID 66113967) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is methyl 3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)butanoate.
| Compound Name | methyl 3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 66113967 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl 3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)butanoate |
| SMILES | COC(=O)CC(C)Sc1cncc2nnnn12 |
| InChI | InChI=1S/C9H11N5O2S/c1-6(3-9(15)16-2)17-8-5-10-4-7-11-12-13-14(7)8/h4-6H,3H2,1-2H3 |
| InChIKey | HEGMWIMGIALHNF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |