C11H18N6 — CID 63202265
N-propyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)butan-2-amine (PubChem CID 63202265) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is N-propyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)butan-2-amine.
| Compound Name | N-propyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 63202265 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | N-propyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)butan-2-amine |
| SMILES | CCCNC(CC)Cc1cncc2nnnn12 |
| InChI | InChI=1S/C11H18N6/c1-3-5-13-9(4-2)6-10-7-12-8-11-14-15-16-17(10)11/h7-9,13H,3-6H2,1-2H3 |
| InChIKey | JECZQHLPRSPCJN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |