About 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide
2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide (PubChem CID 63342412) has the molecular formula C12H18N8S
and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide.
Molecular Properties
| Compound Name | 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide |
| PubChem CID | 63342412 |
| Molecular Formula | C12H18N8S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(c2cncc3nnnn23)CC1 |
| InChI | InChI=1S/C12H18N8S/c1-2-9(12(13)21)18-3-5-19(6-4-18)11-8-14-7-10-15-16-17-20(10)11/h7-9H,2-6H2,1H3,(H2,13,21) |
| InChIKey | WNCCEIOBPGGWNV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide?
The IUPAC name of 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide (CID 63342412) is 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide.
What is the SMILES notation for 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide?
The canonical SMILES for 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide is CCC(C(N)=S)N1CCN(c2cncc3nnnn23)CC1.
What is the InChIKey of 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide?
The InChIKey is WNCCEIOBPGGWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N8S/c1-2-9(12(13)21)18-3-5-19(6-4-18)11-8-14-7-10-15-16-17-20(10)11/h7-9H,2-6H2,1H3,(H2,13,21).
What are the key properties of 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide?
2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide has a molecular weight of 306.40 g/mol, XLogP of -0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(tetrazolo[1,5-a]pyrazin-5-yl)piperazin-1-yl]butanethioamide is sourced from PubChem (CID 63342412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).