C10H16N6S — CID 104925611
N-(5-methylsulfanylpentyl)tetrazolo[1,5-a]pyrazin-5-amine (PubChem CID 104925611) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is N-(5-methylsulfanylpentyl)tetrazolo[1,5-a]pyrazin-5-amine.
| Compound Name | N-(5-methylsulfanylpentyl)tetrazolo[1,5-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 104925611 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(5-methylsulfanylpentyl)tetrazolo[1,5-a]pyrazin-5-amine |
| SMILES | CSCCCCCNc1cncc2nnnn12 |
| InChI | InChI=1S/C10H16N6S/c1-17-6-4-2-3-5-12-9-7-11-8-10-13-14-15-16(9)10/h7-8,12H,2-6H2,1H3 |
| InChIKey | DBCUSKWIVYVWDH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|