About 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine
5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine (PubChem CID 112748206) has the molecular formula C12H17ClN6
and a molecular weight of 280.76 g/mol. Its IUPAC name is 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine |
| PubChem CID | 112748206 |
| Molecular Formula | C12H17ClN6 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine |
| SMILES | CC(Cl)CC1CCCCN1c1cncc2nnnn12 |
| InChI | InChI=1S/C12H17ClN6/c1-9(13)6-10-4-2-3-5-18(10)12-8-14-7-11-15-16-17-19(11)12/h7-10H,2-6H2,1H3 |
| InChIKey | KTZXZYGWPJGDLW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine?
The IUPAC name of 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine (CID 112748206) is 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine is CC(Cl)CC1CCCCN1c1cncc2nnnn12.
What is the InChIKey of 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine?
The InChIKey is KTZXZYGWPJGDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN6/c1-9(13)6-10-4-2-3-5-18(10)12-8-14-7-11-15-16-17-19(11)12/h7-10H,2-6H2,1H3.
What are the key properties of 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine?
5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine has a molecular weight of 280.76 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-chloropropyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine is sourced from PubChem (CID 112748206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).