C10H15N7 — CID 63595440
5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine (PubChem CID 63595440) has the molecular formula C10H15N7 and a molecular weight of 233.28 g/mol. Its IUPAC name is 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine.
| Compound Name | 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 63595440 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine |
| SMILES | CC1(C)CNCCN1c1cncc2nnnn12 |
| InChI | InChI=1S/C10H15N7/c1-10(2)7-11-3-4-16(10)9-6-12-5-8-13-14-15-17(8)9/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | CRURTINBWONKFY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |