About 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine
5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine (PubChem CID 63595440) has the molecular formula C10H15N7
and a molecular weight of 233.28 g/mol. Its IUPAC name is 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine |
| PubChem CID | 63595440 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine |
| SMILES | CC1(C)CNCCN1c1cncc2nnnn12 |
| InChI | InChI=1S/C10H15N7/c1-10(2)7-11-3-4-16(10)9-6-12-5-8-13-14-15-17(8)9/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | CRURTINBWONKFY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine?
The IUPAC name of 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine (CID 63595440) is 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine is CC1(C)CNCCN1c1cncc2nnnn12.
What is the InChIKey of 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine?
The InChIKey is CRURTINBWONKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N7/c1-10(2)7-11-3-4-16(10)9-6-12-5-8-13-14-15-17(8)9/h5-6,11H,3-4,7H2,1-2H3.
What are the key properties of 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine?
5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine has a molecular weight of 233.28 g/mol, XLogP of -0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpiperazin-1-yl)tetrazolo[1,5-a]pyrazine is sourced from PubChem (CID 63595440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).