C11H16N8 — CID 66196007
5-(3-piperazin-1-ylazetidin-1-yl)tetrazolo[1,5-a]pyrazine (PubChem CID 66196007) has the molecular formula C11H16N8 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(3-piperazin-1-ylazetidin-1-yl)tetrazolo[1,5-a]pyrazine.
| Compound Name | 5-(3-piperazin-1-ylazetidin-1-yl)tetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 66196007 |
| Molecular Formula | C11H16N8 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 5-(3-piperazin-1-ylazetidin-1-yl)tetrazolo[1,5-a]pyrazine |
| SMILES | c1ncc2nnnn2c1N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C11H16N8/c1-3-17(4-2-12-1)9-7-18(8-9)11-6-13-5-10-14-15-16-19(10)11/h5-6,9,12H,1-4,7-8H2 |
| InChIKey | YUEKZQBDBRBBGI-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |