About 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine
5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine (PubChem CID 104977511) has the molecular formula C9H13N7
and a molecular weight of 219.25 g/mol. Its IUPAC name is 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine |
| PubChem CID | 104977511 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine |
| SMILES | C[C@H]1CN(c2cncc3nnnn23)CCN1 |
| InChI | InChI=1S/C9H13N7/c1-7-6-15(3-2-11-7)9-5-10-4-8-12-13-14-16(8)9/h4-5,7,11H,2-3,6H2,1H3/t7-/m0/s1 |
| InChIKey | PGCHIFVFWVNKLA-ZETCQYMHSA-N |
| XLogP | -0.68 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine?
The IUPAC name of 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine (CID 104977511) is 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine is C[C@H]1CN(c2cncc3nnnn23)CCN1.
What is the InChIKey of 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine?
The InChIKey is PGCHIFVFWVNKLA-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H13N7/c1-7-6-15(3-2-11-7)9-5-10-4-8-12-13-14-16(8)9/h4-5,7,11H,2-3,6H2,1H3/t7-/m0/s1.
What are the key properties of 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine?
5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine has a molecular weight of 219.25 g/mol, XLogP of -0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-3-methylpiperazin-1-yl]tetrazolo[1,5-a]pyrazine is sourced from PubChem (CID 104977511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).