About [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine
[4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine (PubChem CID 114961729) has the molecular formula C11H17N7
and a molecular weight of 247.31 g/mol. Its IUPAC name is [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine |
| PubChem CID | 114961729 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine |
| SMILES | CC1CCN(c2cncc3nnnn23)CC1CN |
| InChI | InChI=1S/C11H17N7/c1-8-2-3-17(7-9(8)4-12)11-6-13-5-10-14-15-16-18(10)11/h5-6,8-9H,2-4,7,12H2,1H3 |
| InChIKey | JZYPLAZPCCTMIE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine?
The IUPAC name of [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine (CID 114961729) is [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine.
What is the SMILES notation for [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine?
The canonical SMILES for [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine is CC1CCN(c2cncc3nnnn23)CC1CN.
What is the InChIKey of [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine?
The InChIKey is JZYPLAZPCCTMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N7/c1-8-2-3-17(7-9(8)4-12)11-6-13-5-10-14-15-16-18(10)11/h5-6,8-9H,2-4,7,12H2,1H3.
What are the key properties of [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine?
[4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine has a molecular weight of 247.31 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-yl]methanamine is sourced from PubChem (CID 114961729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).