C11H15ClN6 — CID 106838475
5-[4-(1-chloroethyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine (PubChem CID 106838475) has the molecular formula C11H15ClN6 and a molecular weight of 266.74 g/mol. Its IUPAC name is 5-[4-(1-chloroethyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine.
| Compound Name | 5-[4-(1-chloroethyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 106838475 |
| Molecular Formula | C11H15ClN6 |
| Molecular Weight | 266.74 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-[4-(1-chloroethyl)piperidin-1-yl]tetrazolo[1,5-a]pyrazine |
| SMILES | CC(Cl)C1CCN(c2cncc3nnnn23)CC1 |
| InChI | InChI=1S/C11H15ClN6/c1-8(12)9-2-4-17(5-3-9)11-7-13-6-10-14-15-16-18(10)11/h6-9H,2-5H2,1H3 |
| InChIKey | DSHPMVUTIFNDRC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.74 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|