C9H11ClN6 — CID 63389789
5-[2-(chloromethyl)pyrrolidin-1-yl]tetrazolo[1,5-a]pyrazine (PubChem CID 63389789) has the molecular formula C9H11ClN6 and a molecular weight of 238.68 g/mol. Its IUPAC name is 5-[2-(chloromethyl)pyrrolidin-1-yl]tetrazolo[1,5-a]pyrazine.
| Compound Name | 5-[2-(chloromethyl)pyrrolidin-1-yl]tetrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 63389789 |
| Molecular Formula | C9H11ClN6 |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5-[2-(chloromethyl)pyrrolidin-1-yl]tetrazolo[1,5-a]pyrazine |
| SMILES | ClCC1CCCN1c1cncc2nnnn12 |
| InChI | InChI=1S/C9H11ClN6/c10-4-7-2-1-3-15(7)9-6-11-5-8-12-13-14-16(8)9/h5-7H,1-4H2 |
| InChIKey | CAPZDCJAJVIQDP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|