C15H19ClN2O — CID 112748225
2-[2-(2-chloropropyl)piperidin-1-yl]-1,3-benzoxazole (PubChem CID 112748225) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-[2-(2-chloropropyl)piperidin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[2-(2-chloropropyl)piperidin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 112748225 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[2-(2-chloropropyl)piperidin-1-yl]-1,3-benzoxazole |
| SMILES | CC(Cl)CC1CCCCN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H19ClN2O/c1-11(16)10-12-6-4-5-9-18(12)15-17-13-7-2-3-8-14(13)19-15/h2-3,7-8,11-12H,4-6,9-10H2,1H3 |
| InChIKey | ITUVDONFNKACKT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|