C13H14N2O3 — CID 23397359
[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl formate (PubChem CID 23397359) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is [1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl formate.
| Compound Name | [1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl formate |
|---|---|
| PubChem CID | 23397359 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl formate |
| SMILES | O=COCC1CCCN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H14N2O3/c16-9-17-8-10-4-3-7-15(10)13-14-11-5-1-2-6-12(11)18-13/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | XENPNQSLYYQMCQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|