C14H15ClN2O2S — CID 104573341
3-(3-chlorophenyl)-2-(3-propyl-1,2,4-thiadiazol-5-yl)propanoic acid (PubChem CID 104573341) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(3-propyl-1,2,4-thiadiazol-5-yl)propanoic acid.
| Compound Name | 3-(3-chlorophenyl)-2-(3-propyl-1,2,4-thiadiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 104573341 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(3-propyl-1,2,4-thiadiazol-5-yl)propanoic acid |
| SMILES | CCCc1nsc(C(Cc2cccc(Cl)c2)C(=O)O)n1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-2-4-12-16-13(20-17-12)11(14(18)19)8-9-5-3-6-10(15)7-9/h3,5-7,11H,2,4,8H2,1H3,(H,18,19) |
| InChIKey | DOPCHKHXKZZTAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |