3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid

C11H9ClN2O2S — CID 104573332

IUPAC3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1)c1ncns1
InChIInChI=1S/C11H9ClN2O2S/c12-8-3-1-2-7(4-8)5-9(11(15)16)10-13-6-14-17-10/h1-4,6,9H,5H2,(H,15,16)
InChIKeyRUPHOJQQZSXIPY-UHFFFAOYSA-N
MW268.72 g/mol
LogP2.60
Rot. Bonds4

About 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid

3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid (PubChem CID 104573332) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid
PubChem CID104573332
Molecular FormulaC11H9ClN2O2S
Molecular Weight268.72 g/mol
Exact Mass268.01
IUPAC Name3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid
SMILESO=C(O)C(Cc1cccc(Cl)c1)c1ncns1
InChIInChI=1S/C11H9ClN2O2S/c12-8-3-1-2-7(4-8)5-9(11(15)16)10-13-6-14-17-10/h1-4,6,9H,5H2,(H,15,16)
InChIKeyRUPHOJQQZSXIPY-UHFFFAOYSA-N
XLogP2.60
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.72
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid?
The IUPAC name of 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid (CID 104573332) is 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid?
The canonical SMILES for 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid is O=C(O)C(Cc1cccc(Cl)c1)c1ncns1.
What is the InChIKey of 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid?
The InChIKey is RUPHOJQQZSXIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O2S/c12-8-3-1-2-7(4-8)5-9(11(15)16)10-13-6-14-17-10/h1-4,6,9H,5H2,(H,15,16).
What are the key properties of 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid?
3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid has a molecular weight of 268.72 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-2-(1,2,4-thiadiazol-5-yl)propanoic acid is sourced from PubChem (CID 104573332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).