C18H31N3 — CID 104575861
5-(4-tert-butylcyclohexyl)-2-ethyl-3-prop-2-enylimidazol-4-amine (PubChem CID 104575861) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 5-(4-tert-butylcyclohexyl)-2-ethyl-3-prop-2-enylimidazol-4-amine.
| Compound Name | 5-(4-tert-butylcyclohexyl)-2-ethyl-3-prop-2-enylimidazol-4-amine |
|---|---|
| PubChem CID | 104575861 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 5-(4-tert-butylcyclohexyl)-2-ethyl-3-prop-2-enylimidazol-4-amine |
| SMILES | C=CCn1c(CC)nc(C2CCC(C(C)(C)C)CC2)c1N |
| InChI | InChI=1S/C18H31N3/c1-6-12-21-15(7-2)20-16(17(21)19)13-8-10-14(11-9-13)18(3,4)5/h6,13-14H,1,7-12,19H2,2-5H3 |
| InChIKey | CZYAMXLXLHWBGX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|