C17H32N4 — CID 104575874
2-tert-butyl-4-(4-tert-butylcyclohexyl)imidazole-1,5-diamine (PubChem CID 104575874) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-tert-butyl-4-(4-tert-butylcyclohexyl)imidazole-1,5-diamine.
| Compound Name | 2-tert-butyl-4-(4-tert-butylcyclohexyl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 104575874 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-tert-butyl-4-(4-tert-butylcyclohexyl)imidazole-1,5-diamine |
| SMILES | CC(C)(C)c1nc(C2CCC(C(C)(C)C)CC2)c(N)n1N |
| InChI | InChI=1S/C17H32N4/c1-16(2,3)12-9-7-11(8-10-12)13-14(18)21(19)15(20-13)17(4,5)6/h11-12H,7-10,18-19H2,1-6H3 |
| InChIKey | HNSPNEJLURIGSE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |