C11H20N4S — CID 107133535
2-tert-butyl-4-(thiolan-3-yl)imidazole-1,5-diamine (PubChem CID 107133535) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 2-tert-butyl-4-(thiolan-3-yl)imidazole-1,5-diamine.
| Compound Name | 2-tert-butyl-4-(thiolan-3-yl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 107133535 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-tert-butyl-4-(thiolan-3-yl)imidazole-1,5-diamine |
| SMILES | CC(C)(C)c1nc(C2CCSC2)c(N)n1N |
| InChI | InChI=1S/C11H20N4S/c1-11(2,3)10-14-8(9(12)15(10)13)7-4-5-16-6-7/h7H,4-6,12-13H2,1-3H3 |
| InChIKey | MCTBIFPIFUIFJA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |