C13H11N5O — CID 104580556
N-(1H-imidazol-5-ylmethyl)quinoxaline-5-carboxamide (PubChem CID 104580556) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)quinoxaline-5-carboxamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104580556 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)quinoxaline-5-carboxamide |
| SMILES | O=C(NCc1cnc[nH]1)c1cccc2nccnc12 |
| InChI | InChI=1S/C13H11N5O/c19-13(17-7-9-6-14-8-18-9)10-2-1-3-11-12(10)16-5-4-15-11/h1-6,8H,7H2,(H,14,18)(H,17,19) |
| InChIKey | HBWKOPQCUWVUJW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |