C11H11Br2NO — CID 104581528
2,4-dibromo-6-[1-(prop-2-ynylamino)ethyl]phenol (PubChem CID 104581528) has the molecular formula C11H11Br2NO and a molecular weight of 333.02 g/mol. Its IUPAC name is 2,4-dibromo-6-[1-(prop-2-ynylamino)ethyl]phenol.
| Compound Name | 2,4-dibromo-6-[1-(prop-2-ynylamino)ethyl]phenol |
|---|---|
| PubChem CID | 104581528 |
| Molecular Formula | C11H11Br2NO |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | 2,4-dibromo-6-[1-(prop-2-ynylamino)ethyl]phenol |
| SMILES | C#CCNC(C)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C11H11Br2NO/c1-3-4-14-7(2)9-5-8(12)6-10(13)11(9)15/h1,5-7,14-15H,4H2,2H3 |
| InChIKey | XXFPYNLVWCZDEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|