C11H14Br2FNO — CID 104583430
2,4-dibromo-6-[1-(3-fluoropropylamino)ethyl]phenol (PubChem CID 104583430) has the molecular formula C11H14Br2FNO and a molecular weight of 355.05 g/mol. Its IUPAC name is 2,4-dibromo-6-[1-(3-fluoropropylamino)ethyl]phenol.
| Compound Name | 2,4-dibromo-6-[1-(3-fluoropropylamino)ethyl]phenol |
|---|---|
| PubChem CID | 104583430 |
| Molecular Formula | C11H14Br2FNO |
| Molecular Weight | 355.05 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 2,4-dibromo-6-[1-(3-fluoropropylamino)ethyl]phenol |
| SMILES | CC(NCCCF)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C11H14Br2FNO/c1-7(15-4-2-3-14)9-5-8(12)6-10(13)11(9)16/h5-7,15-16H,2-4H2,1H3 |
| InChIKey | NIWMQPQCVBMEHL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.05 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|