C10H13F2NO2 — CID 104581588
2,4-difluoro-6-[1-(2-hydroxyethylamino)ethyl]phenol (PubChem CID 104581588) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 2,4-difluoro-6-[1-(2-hydroxyethylamino)ethyl]phenol.
| Compound Name | 2,4-difluoro-6-[1-(2-hydroxyethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 104581588 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2,4-difluoro-6-[1-(2-hydroxyethylamino)ethyl]phenol |
| SMILES | CC(NCCO)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C10H13F2NO2/c1-6(13-2-3-14)8-4-7(11)5-9(12)10(8)15/h4-6,13-15H,2-3H2,1H3 |
| InChIKey | OLNUCSKENBTNJS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|