C18H29N3O9P2 — CID 10458387
[1-hydroxy-4-[[(2S)-3-phenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]-1-phosphonobutyl]phosphonic acid (PubChem CID 10458387) has the molecular formula C18H29N3O9P2 and a molecular weight of 493.39 g/mol. Its IUPAC name is [1-hydroxy-4-[[(2S)-3-phenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-[[(2S)-3-phenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 10458387 |
| Molecular Formula | C18H29N3O9P2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [1-hydroxy-4-[[(2S)-3-phenyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]amino]-1-phosphonobutyl]phosphonic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H29N3O9P2/c22-16(20-11-5-9-18(24,31(25,26)27)32(28,29)30)15(12-13-6-2-1-3-7-13)21-17(23)14-8-4-10-19-14/h1-3,6-7,14-15,19,24H,4-5,8-12H2,(H,20,22)(H,21,23)(H2,25,26,27)(H2,28,29,30)/t14-,15-/m0/s1 |
| InChIKey | OVXYGZIWIVQKBL-GJZGRUSLSA-N |
| XLogP | -0.64 |
| TPSA | 205.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|