C24H34OSiTe — CID 10458421
tert-butyl-(1-butyltellanyl-2,2-diphenylethenoxy)-dimethylsilane (PubChem CID 10458421) has the molecular formula C24H34OSiTe and a molecular weight of 494.22 g/mol. Its IUPAC name is tert-butyl-(1-butyltellanyl-2,2-diphenylethenoxy)-dimethylsilane.
| Compound Name | tert-butyl-(1-butyltellanyl-2,2-diphenylethenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 10458421 |
| Molecular Formula | C24H34OSiTe |
| Molecular Weight | 494.22 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | tert-butyl-(1-butyltellanyl-2,2-diphenylethenoxy)-dimethylsilane |
| SMILES | CCCC[Te]C(O[Si](C)(C)C(C)(C)C)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H34OSiTe/c1-7-8-19-27-23(25-26(5,6)24(2,3)4)22(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18H,7-8,19H2,1-6H3 |
| InChIKey | AIXRDQSUBIRGFI-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.22 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|