C14H21NO4 — CID 104586370
methyl 5-[[(2-hydroxycyclohexyl)methylamino]methyl]furan-3-carboxylate (PubChem CID 104586370) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 5-[[(2-hydroxycyclohexyl)methylamino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[(2-hydroxycyclohexyl)methylamino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104586370 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 5-[[(2-hydroxycyclohexyl)methylamino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCC2CCCCC2O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-18-14(17)11-6-12(19-9-11)8-15-7-10-4-2-3-5-13(10)16/h6,9-10,13,15-16H,2-5,7-8H2,1H3 |
| InChIKey | NMRCKRLRURRSGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |