C11H12N6O3 — CID 104586731
2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-5-nitropyridine-3-carboxamide (PubChem CID 104586731) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-5-nitropyridine-3-carboxamide.
| Compound Name | 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 104586731 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-5-nitropyridine-3-carboxamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)c1cc([N+](=O)[O-])cnc1N |
| InChI | InChI=1S/C11H12N6O3/c1-5-9(6(2)16-15-5)14-11(18)8-3-7(17(19)20)4-13-10(8)12/h3-4H,1-2H3,(H2,12,13)(H,14,18)(H,15,16) |
| InChIKey | FQIDPJJKZWKOTR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|