C9H9N3O2S2 — CID 104589023
1-(5-nitrothiophen-3-yl)-N-(1,3-thiazol-5-ylmethyl)methanamine (PubChem CID 104589023) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-(5-nitrothiophen-3-yl)-N-(1,3-thiazol-5-ylmethyl)methanamine.
| Compound Name | 1-(5-nitrothiophen-3-yl)-N-(1,3-thiazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 104589023 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 1-(5-nitrothiophen-3-yl)-N-(1,3-thiazol-5-ylmethyl)methanamine |
| SMILES | O=[N+]([O-])c1cc(CNCc2cncs2)cs1 |
| InChI | InChI=1S/C9H9N3O2S2/c13-12(14)9-1-7(5-15-9)2-10-3-8-4-11-6-16-8/h1,4-6,10H,2-3H2 |
| InChIKey | QEOZXZWRBRNBBD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|