C11H11FN2OS — CID 104589056
4-fluoro-2-[(1,3-thiazol-5-ylmethylamino)methyl]phenol (PubChem CID 104589056) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-fluoro-2-[(1,3-thiazol-5-ylmethylamino)methyl]phenol.
| Compound Name | 4-fluoro-2-[(1,3-thiazol-5-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 104589056 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-fluoro-2-[(1,3-thiazol-5-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(F)cc1CNCc1cncs1 |
| InChI | InChI=1S/C11H11FN2OS/c12-9-1-2-11(15)8(3-9)4-13-5-10-6-14-7-16-10/h1-3,6-7,13,15H,4-5H2 |
| InChIKey | CUIJFQVNIZPZIC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|