C10H7ClFNS — CID 90882349
5-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazole (PubChem CID 90882349) has the molecular formula C10H7ClFNS and a molecular weight of 227.69 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazole.
| Compound Name | 5-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 90882349 |
| Molecular Formula | C10H7ClFNS |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenyl)methyl]-1,3-thiazole |
| SMILES | Fc1ccc(Cc2cncs2)c(Cl)c1 |
| InChI | InChI=1S/C10H7ClFNS/c11-10-4-8(12)2-1-7(10)3-9-5-13-6-14-9/h1-2,4-6H,3H2 |
| InChIKey | KEKXPVMXLAABFT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |