C11H11NOS2 — CID 104591016
3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol (PubChem CID 104591016) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol.
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol |
|---|---|
| PubChem CID | 104591016 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol |
| SMILES | Cc1nc(Sc2cccc(O)c2)sc1C |
| InChI | InChI=1S/C11H11NOS2/c1-7-8(2)14-11(12-7)15-10-5-3-4-9(13)6-10/h3-6,13H,1-2H3 |
| InChIKey | QFSAQMXMQSDDEK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |