About 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol
3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol (PubChem CID 104591016) has the molecular formula C11H11NOS2
and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol.
Molecular Properties
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol |
| PubChem CID | 104591016 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol |
| SMILES | Cc1nc(Sc2cccc(O)c2)sc1C |
| InChI | InChI=1S/C11H11NOS2/c1-7-8(2)14-11(12-7)15-10-5-3-4-9(13)6-10/h3-6,13H,1-2H3 |
| InChIKey | QFSAQMXMQSDDEK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol?
The IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol (CID 104591016) is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol.
What is the SMILES notation for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol?
The canonical SMILES for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol is Cc1nc(Sc2cccc(O)c2)sc1C.
What is the InChIKey of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol?
The InChIKey is QFSAQMXMQSDDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS2/c1-7-8(2)14-11(12-7)15-10-5-3-4-9(13)6-10/h3-6,13H,1-2H3.
What are the key properties of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol?
3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol has a molecular weight of 237.35 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]phenol is sourced from PubChem (CID 104591016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).