C11H11N3OS — CID 114448832
3-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]phenol (PubChem CID 114448832) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]phenol.
| Compound Name | 3-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]phenol |
|---|---|
| PubChem CID | 114448832 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]phenol |
| SMILES | Cc1nnc(Sc2cccc(O)c2)nc1C |
| InChI | InChI=1S/C11H11N3OS/c1-7-8(2)13-14-11(12-7)16-10-5-3-4-9(15)6-10/h3-6,15H,1-2H3 |
| InChIKey | BCDALSADIWLICS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |