C15H13N3OS — CID 114787358
4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]naphthalen-1-ol (PubChem CID 114787358) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]naphthalen-1-ol.
| Compound Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 114787358 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-[(5,6-dimethyl-1,2,4-triazin-3-yl)sulfanyl]naphthalen-1-ol |
| SMILES | Cc1nnc(Sc2ccc(O)c3ccccc23)nc1C |
| InChI | InChI=1S/C15H13N3OS/c1-9-10(2)17-18-15(16-9)20-14-8-7-13(19)11-5-3-4-6-12(11)14/h3-8,19H,1-2H3 |
| InChIKey | IBWRHFOZZMRHRU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |