C17H21NOS — CID 170707186
methanamine;3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)phenol (PubChem CID 170707186) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is methanamine;3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)phenol.
| Compound Name | methanamine;3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)phenol |
|---|---|
| PubChem CID | 170707186 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | methanamine;3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)phenol |
| SMILES | CN.Oc1cccc(Sc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C16H16OS.CH5N/c17-14-6-3-7-15(11-14)18-16-9-8-12-4-1-2-5-13(12)10-16;1-2/h3,6-11,17H,1-2,4-5H2;2H2,1H3 |
| InChIKey | CHCZFFATKKQENC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |